EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H26ClF3N6O3 |
| Net Charge | 0 |
| Average Mass | 574.991 |
| Monoisotopic Mass | 574.17070 |
| SMILES | CCOC(=O)[C@@H](N)Cc1ccc(-c2cc(O[C@H](c3ccc(Cl)cc3-n3ccc(C)n3)C(F)(F)F)nc(N)n2)cc1 |
| InChI | InChI=1S/C27H26ClF3N6O3/c1-3-39-25(38)20(32)12-16-4-6-17(7-5-16)21-14-23(35-26(33)34-21)40-24(27(29,30)31)19-9-8-18(28)13-22(19)37-11-10-15(2)36-37/h4-11,13-14,20,24H,3,12,32H2,1-2H3,(H2,33,34,35)/t20-,24+/m0/s1 |
| InChIKey | MDSQOJYHHZBZKA-GBXCKJPGSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| telotristat ethyl (CHEBI:751580) has role antineoplastic agent (CHEBI:35610) |
| telotristat ethyl (CHEBI:751580) has role cardiovascular drug (CHEBI:35554) |
| telotristat ethyl (CHEBI:751580) is a phenylalanine derivative (CHEBI:25985) |
| Synonyms | Source |
|---|---|
| LX 1032 | ChEMBL |
| LX-1032 | ChEMBL |
| LX1032 | ChEMBL |
| LX 1606 | ChEMBL |
| LX-1606 | ChEMBL |
| LX1606 | ChEMBL |
| Brand Name | Source |
|---|---|
| Xermelo | ChEMBL |
| Citations |
|---|