EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.C41H52N4O4S |
| Net Charge | 0 |
| Average Mass | 793.065 |
| Monoisotopic Mass | 792.35904 |
| SMILES | CCCCOCCOc1ccc(-c2ccc3c(c2)/C=C(/C(=O)Nc2ccc([S@@+]([O-])Cc4cncn4CCC)cc2)CCCN3CC(C)C)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C41H52N4O4S.CH4O3S/c1-5-7-22-48-23-24-49-38-15-10-32(11-16-38)33-12-19-40-35(25-33)26-34(9-8-21-44(40)28-31(3)4)41(46)43-36-13-17-39(18-14-36)50(47)29-37-27-42-30-45(37)20-6-2;1-5(2,3)4/h10-19,25-27,30-31H,5-9,20-24,28-29H2,1-4H3,(H,43,46);1H3,(H,2,3,4)/b34-26+;/t50-;/m0./s1 |
| InChIKey | IXPBPUPDRDCRSY-YLZLUMLXSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cenicriviroc mesylate (CHEBI:751575) has role anti-HIV agent (CHEBI:64946) |
| cenicriviroc mesylate (CHEBI:751575) is a anilide (CHEBI:13248) |
| Synonyms | Source |
|---|---|
| Cenicriviroc mesilate | ChEMBL |
| Cenicriviroc mesylate | ChEMBL |
| Citations |
|---|