EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O6.C6H13NO3 |
| Net Charge | 0 |
| Average Mass | 297.260 |
| Monoisotopic Mass | 297.10598 |
| SMILES | O=C(O)C(O)C(O)C(=O)O.OC[C@H]1CNC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO3.C4H6O6/c8-3-4-1-7-2-5(9)6(4)10;5-1(3(7)8)2(6)4(9)10/h4-10H,1-3H2;1-2,5-6H,(H,7,8)(H,9,10)/t4-,5-,6-;/m1./s1 |
| InChIKey | ULBPPCHRAVUQMC-RWOHWRPJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| afegostat tartrate (CHEBI:751563) is a heterocyclic fatty acid (CHEBI:48847) |
| Synonyms | Source |
|---|---|
| Afegostat tartrate | ChEMBL |
| AT-2101 | ChEMBL |
| AT2101 | ChEMBL |
| HGT-3410 | ChEMBL |
| Isofagomine tartrate | ChEMBL |
| Plicera | ChEMBL |
| Citations |
|---|