EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H72N2O9 |
| Net Charge | 0 |
| Average Mass | 905.186 |
| Monoisotopic Mass | 904.52378 |
| SMILES | CCc1c2c(nc3ccc(OC(=O)CCC(=O)Oc4c(C)c(C)c5c(c4C)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O5)cc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@]3(O)CC |
| InChI | InChI=1S/C55H72N2O9/c1-11-39-41-28-38(21-22-45(41)56-49-42(39)30-57-46(49)29-44-43(52(57)60)31-63-53(61)55(44,62)12-2)64-47(58)23-24-48(59)65-50-35(7)36(8)51-40(37(50)9)25-27-54(10,66-51)26-15-20-34(6)19-14-18-33(5)17-13-16-32(3)4/h21-22,28-29,32-34,62H,11-20,23-27,30-31H2,1-10H3/t33-,34-,54-,55+/m1/s1 |
| InChIKey | KRHZRBUSQSYTTP-PTXGIJCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenifatecan (CHEBI:751561) has role antineoplastic agent (CHEBI:35610) |
| tenifatecan (CHEBI:751561) is a tocol (CHEBI:39437) |
| INN | Source |
|---|---|
| tenifatecan | WHO MedNet |
| Synonyms | Source |
|---|---|
| SN-2310 | ChEMBL |
| SN2310 | ChEMBL |