EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H37N5O4S2 |
| Net Charge | 0 |
| Average Mass | 511.714 |
| Monoisotopic Mass | 511.22870 |
| SMILES | CCNCCS(=O)(=O)NC[C@@]1(c2ccccc2)SC(NC(=O)C(C)(C)C)=NN1C(=O)C(C)(C)C |
| InChI | InChI=1S/C23H37N5O4S2/c1-8-24-14-15-34(31,32)25-16-23(17-12-10-9-11-13-17)28(19(30)22(5,6)7)27-20(33-23)26-18(29)21(2,3)4/h9-13,24-25H,8,14-16H2,1-7H3,(H,26,27,29)/t23-/m0/s1 |
| InChIKey | YVAFBXLHPINSIK-QHCPKHFHSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| litronesib (CHEBI:751559) has role antineoplastic agent (CHEBI:35610) |
| litronesib (CHEBI:751559) is a benzenes (CHEBI:22712) |
| INN | Source |
|---|---|
| litronesib | WHO MedNet |
| Synonyms | Source |
|---|---|
| KF 89617 | ChEMBL |
| KF-89617 | ChEMBL |
| KF89617 | ChEMBL |
| LY 2523355 | ChEMBL |
| LY-2523355 | ChEMBL |
| LY2523355 | ChEMBL |
| Citations |
|---|