EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H11NO3.C18H21O8P |
| Net Charge | 0 |
| Average Mass | 517.468 |
| Monoisotopic Mass | 517.17130 |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OP(=O)(O)O.NC(CO)(CO)CO |
| InChI | InChI=1S/C18H21O8P.C4H11NO3/c1-22-14-8-7-12(9-15(14)26-27(19,20)21)5-6-13-10-16(23-2)18(25-4)17(11-13)24-3;5-4(1-6,2-7)3-8/h5-11H,1-4H3,(H2,19,20,21);6-8H,1-3,5H2/b6-5-; |
| InChIKey | FIDMEHCRMLKKPZ-YSMBQZINSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosbretabulin tromethamine (CHEBI:751546) has role antineoplastic agent (CHEBI:35610) |
| fosbretabulin tromethamine (CHEBI:751546) is a stilbenoid (CHEBI:26776) |
| Synonym | Source |
|---|---|
| Fosbretabulin tromethamine | ChEMBL |
| Brand Name | Source |
|---|---|
| Zybrestat | ChEMBL |