EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12ClF3N4O4 |
| Net Charge | 0 |
| Average Mass | 440.765 |
| Monoisotopic Mass | 440.04992 |
| SMILES | Nc1nc(-n2cc(C(=O)O)c(=O)c3cc(F)c(N4CC(O)C4)c(Cl)c32)c(F)cc1F |
| InChI | InChI=1S/C18H12ClF3N4O4/c19-12-13-7(1-9(20)14(12)25-3-6(27)4-25)15(28)8(18(29)30)5-26(13)17-11(22)2-10(21)16(23)24-17/h1-2,5-6,27H,3-4H2,(H2,23,24)(H,29,30) |
| InChIKey | DYDCPNMLZGFQTM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delafloxacin (CHEBI:751540) has role antibacterial agent (CHEBI:33282) |
| delafloxacin (CHEBI:751540) has role antiinfective agent (CHEBI:35441) |
| delafloxacin (CHEBI:751540) has role antimicrobial agent (CHEBI:33281) |
| delafloxacin (CHEBI:751540) is a quinolines (CHEBI:26513) |
| INNs | Source |
|---|---|
| delafloxacine | WHO MedNet |
| delafloxacino | WHO MedNet |
| Synonyms | Source |
|---|---|
| ABT-492 | ChEMBL |
| Delafloxacin | ChEMBL |
| RX-3341 | ChEMBL |
| WQ-3034 | ChEMBL |
| Citations |
|---|