EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H31I2NO5 |
| Net Charge | 0 |
| Average Mass | 703.355 |
| Monoisotopic Mass | 703.02917 |
| SMILES | CC[C@H](C)OC(=O)Cc1oc2ccccc2c1C(=O)c1cc(I)c(OCCN(CC)CC)c(I)c1 |
| InChI | InChI=1S/C27H31I2NO5/c1-5-17(4)34-24(31)16-23-25(19-10-8-9-11-22(19)35-23)26(32)18-14-20(28)27(21(29)15-18)33-13-12-30(6-2)7-3/h8-11,14-15,17H,5-7,12-13,16H2,1-4H3/t17-/m0/s1 |
| InChIKey | ZXOSVKYCXLTVGS-KRWDZBQOSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| budiodarone (CHEBI:751534) has role anti-arrhythmia drug (CHEBI:38070) |
| budiodarone (CHEBI:751534) is a aromatic ketone (CHEBI:76224) |
| INNs | Source |
|---|---|
| budiodarona | WHO MedNet |
| budiodarone | WHO MedNet |
| Synonym | Source |
|---|---|
| ATI-2042 | ChEMBL |