EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C32H48N4O8 |
| Net Charge | 0 |
| Average Mass | 653.217 |
| Monoisotopic Mass | 652.32389 |
| SMILES | CO[C@H]1/C=C\C=C(/C)C(=O)NC2=CC(=O)C(NCCN(C)C)=C(C[C@@H](C)C[C@H](OC)[C@H](O)[C@@H](C)/C=C(\C)[C@@H]1OC(N)=O)C2=O.Cl |
| InChI | InChI=1S/C32H48N4O8.ClH/c1-18-14-22-27(34-12-13-36(5)6)24(37)17-23(29(22)39)35-31(40)19(2)10-9-11-25(42-7)30(44-32(33)41)21(4)16-20(3)28(38)26(15-18)43-8;/h9-11,16-18,20,25-26,28,30,34,38H,12-15H2,1-8H3,(H2,33,41)(H,35,40);1H/b11-9-,19-10+,21-16+;/t18-,20+,25+,26+,28-,30+;/m1./s1 |
| InChIKey | DFSYBWLNYPEFJK-IHLRWNDRSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alvespimycin hydrochloride (CHEBI:751533) has role antineoplastic agent (CHEBI:35610) |
| alvespimycin hydrochloride (CHEBI:751533) is a carbamate ester (CHEBI:23003) |
| Synonyms | Source |
|---|---|
| 17-dmag hcl | ChEMBL |
| Alvespimycin hcl | ChEMBL |
| Alvespimycin hydrochloride | ChEMBL |
| BMS-826476 | ChEMBL |
| KOS-1022 | ChEMBL |
| Citations |
|---|