EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O6.C45H54F2N4O8.C4H6O6 |
| Net Charge | 0 |
| Average Mass | 1117.115 |
| Monoisotopic Mass | 1116.42385 |
| SMILES | O=C(O)C(O)C(O)C(=O)O.O=C(O)C(O)C(O)C(=O)O.[H][C@]12C[C@@H](C(C)(F)F)CN(Cc3c(nc4ccccc34)[C@@](C(=O)OC)(c3cc4c(cc3OC)N(C)[C@]3([H])[C@]45CCN4CC=C[C@@](CC)([C@@H](OC(C)=O)[C@]3(O)C(=O)OC)[C@]45[H])C1)C2 |
| InChI | InChI=1S/C45H54F2N4O8.2C4H6O6/c1-8-42-14-11-16-51-17-15-43(36(42)51)30-19-31(34(56-5)20-33(30)49(4)37(43)45(55,40(54)58-7)38(42)59-25(2)52)44(39(53)57-6)21-26-18-27(41(3,46)47)23-50(22-26)24-29-28-12-9-10-13-32(28)48-35(29)44;2*5-1(3(7)8)2(6)4(9)10/h9-14,19-20,26-27,36-38,48,55H,8,15-18,21-24H2,1-7H3;2*1-2,5-6H,(H,7,8)(H,9,10)/t26-,27+,36-,37+,38+,42+,43+,44-,45-;;/m0../s1 |
| InChIKey | YIHUEPHBPPAAHH-PEPODRRYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vinflunine ditartrate (CHEBI:751532) has role antineoplastic agent (CHEBI:35610) |
| vinflunine ditartrate (CHEBI:751532) is a vinca alkaloid (CHEBI:27288) |
| Synonyms | Source |
|---|---|
| BMS-710485 | ChEMBL |
| F-12158 | ChEMBL |
| Vinflunine bitartrate | ChEMBL |
| Vinflunine tartrate | ChEMBL |