EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:751502 - tosifen
| Formula | C17H20N2O3S |
| Net Charge | 0 |
| Average Mass | 332.425 |
| Monoisotopic Mass | 332.11946 |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)N[C@@H](C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2O3S/c1-13-8-10-16(11-9-13)23(21,22)19-17(20)18-14(2)12-15-6-4-3-5-7-15/h3-11,14H,12H2,1-2H3,(H2,18,19,20)/t14-/m0/s1 |
| InChIKey | XILWEASNBDKGSA-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tosifen (CHEBI:751502) is a amphetamines (CHEBI:35338) |
| INNs | Source |
|---|---|
| tosifen | WHO MedNet |
| tosifene | WHO MedNet |
| tosifeno | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-310670 | ChEMBL |
| SCH 11973 | ChEMBL |
| SCH-11973 | ChEMBL |