EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11N5O5S |
| Net Charge | 0 |
| Average Mass | 289.273 |
| Monoisotopic Mass | 289.04809 |
| SMILES | Cn1c([N+](=O)[O-])cnc1N1CCN(S(C)(=O)=O)C1=O |
| InChI | InChI=1S/C8H11N5O5S/c1-10-6(13(15)16)5-9-7(10)11-3-4-12(8(11)14)19(2,17)18/h5H,3-4H2,1-2H3 |
| InChIKey | FNSHYEAUAUHIMB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| satranidazole (CHEBI:751487) has role antiamoebic agent (CHEBI:171664) |
| satranidazole (CHEBI:751487) is a C-nitro compound (CHEBI:35716) |
| satranidazole (CHEBI:751487) is a imidazoles (CHEBI:24780) |
| INN | Source |
|---|---|
| satranidazol | WHO MedNet |
| Synonym | Source |
|---|---|
| Satranidazole | ChEMBL |