EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O4 |
| Net Charge | 0 |
| Average Mass | 132.115 |
| Monoisotopic Mass | 132.04226 |
| SMILES | COC(=O)CCC(=O)O |
| InChI | InChI=1S/C5H8O4/c1-9-5(8)3-2-4(6)7/h2-3H2,1H3,(H,6,7) |
| InChIKey | JDRMYOQETPMYQX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monomethyl succinate (CHEBI:75146) is a dicarboxylic acid monoester (CHEBI:36244) |
| monomethyl succinate (CHEBI:75146) is a hemisuccinate (CHEBI:138979) |
| IUPAC Name |
|---|
| 4-methoxy-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| 3-carbomethoxypropanoic acid | ChemIDplus |
| butanedioic acid 1-methyl ester | ChemIDplus |
| butanedioic acid, 1-methyl ester | ChemIDplus |
| butanedioic acid monomethyl ester | ChEBI |
| methyl hydrogen succinate | ChemIDplus |
| succinic acid 4-methyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CN101823961 | Patent |
| Citations |
|---|