EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H41N3O5 |
| Net Charge | 0 |
| Average Mass | 475.630 |
| Monoisotopic Mass | 475.30462 |
| SMILES | [H]C(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H41N3O5/c1-17(2)12-21(15-30)27-24(31)22(13-18(3)4)28-25(32)23(14-19(5)6)29-26(33)34-16-20-10-8-7-9-11-20/h7-11,15,17-19,21-23H,12-14,16H2,1-6H3,(H,27,31)(H,28,32)(H,29,33)/t21-,22-,23-/m0/s1 |
| InChIKey | TZYWCYJVHRLUCT-VABKMULXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzyloxycarbonyl-L-leucyl-L-leucyl-L-leucinal (CHEBI:75142) has role proteasome inhibitor (CHEBI:52726) |
| N-benzyloxycarbonyl-L-leucyl-L-leucyl-L-leucinal (CHEBI:75142) is a amino aldehyde (CHEBI:22492) |
| N-benzyloxycarbonyl-L-leucyl-L-leucyl-L-leucinal (CHEBI:75142) is a carbamate ester (CHEBI:23003) |
| N-benzyloxycarbonyl-L-leucyl-L-leucyl-L-leucinal (CHEBI:75142) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| N-[(benzyloxy)carbonyl]-L-leucyl-N-[(2S)-4-methyl-1-oxopentan-2-yl]-L-leucinamide |
| Synonyms | Source |
|---|---|
| benzyloxycarbonyl-leucyl-leucyl-leucinal | ChemIDplus |
| benzyloxycarbonylleucyl-leucyl-leucine aldehyde | ChemIDplus |
| benzyloxycarbonyl-leu-leu-leu-aldehyde | ChemIDplus |
| carbobenzoxy-leucyl-leucyl-leucinal | ChemIDplus |
| carbobenzoxy-Leu-Leu-leucinal | ChEBI |
| carbobenzoxyl-leucinyl-leucinyl-leucinal-H | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-1107 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7668447 | Reaxys |
| CAS:133407-82-6 | ChemIDplus |
| CAS:133407-82-6 | ChemIDplus |
| Citations |
|---|