EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O5 |
| Net Charge | 0 |
| Average Mass | 360.450 |
| Monoisotopic Mass | 360.19367 |
| SMILES | [H][C@@]12CC[C@](C)(O)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C(C(=O)O)=C[C@@]21C |
| InChI | InChI=1S/C21H28O5/c1-19-9-13(18(24)25)15(22)8-11(19)4-5-12-14-6-7-21(3,26)20(14,2)10-16(23)17(12)19/h8-9,12,14,16-17,23,26H,4-7,10H2,1-3H3,(H,24,25)/t12-,14-,16-,17+,19-,20-,21-/m0/s1 |
| InChIKey | JOFBZBDWOWPUMO-QARKFJNLSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roxibolone (CHEBI:751396) has role androgen (CHEBI:50113) |
| roxibolone (CHEBI:751396) is a 3-hydroxy steroid (CHEBI:36834) |
| INNs | Source |
|---|---|
| roxibolona | WHO MedNet |
| roxibolone | WHO MedNet |
| Synonym | Source |
|---|---|
| BR-906 | ChEMBL |