EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23NO3 |
| Net Charge | 0 |
| Average Mass | 277.364 |
| Monoisotopic Mass | 277.16779 |
| SMILES | COc1cccc(C(=O)OCCCN2CCCCC2)c1 |
| InChI | InChI=1S/C16H23NO3/c1-19-15-8-5-7-14(13-15)16(18)20-12-6-11-17-9-3-2-4-10-17/h5,7-8,13H,2-4,6,9-12H2,1H3 |
| InChIKey | MDEHCYRQFACAGY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pribecaine (CHEBI:751343) is a methoxybenzoic acid (CHEBI:25238) |
| INNs | Source |
|---|---|
| pribecaina | WHO MedNet |
| pribecaine | WHO MedNet |