EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:751315 - plomestane
| Formula | C21H26O2 |
| Net Charge | 0 |
| Average Mass | 310.437 |
| Monoisotopic Mass | 310.19328 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(CC#C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C21H26O2/c1-3-10-21-12-8-15(22)13-14(21)4-5-16-17-6-7-19(23)20(17,2)11-9-18(16)21/h1,13,16-18H,4-12H2,2H3/t16-,17-,18-,20-,21-/m0/s1 |
| InChIKey | JKPDEYAOCSQBSZ-OEUJLIAZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plomestane (CHEBI:751315) is a 3-hydroxy steroid (CHEBI:36834) |
| INNs | Source |
|---|---|
| plomestane | WHO MedNet |
| plomestano | WHO MedNet |
| Synonyms | Source |
|---|---|
| MDL 18,962 | ChEMBL |
| MDL-18962 | ChEMBL |
| Citations |
|---|