EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H50N2O3 |
| Net Charge | 0 |
| Average Mass | 474.730 |
| Monoisotopic Mass | 474.38214 |
| SMILES | CCCCCCCCCCCCCCCC(=O)N[C@@H](CN1CCOCC1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C29H50N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-20-28(32)30-27(25-31-21-23-34-24-22-31)29(33)26-18-15-14-16-19-26/h14-16,18-19,27,29,33H,2-13,17,20-25H2,1H3,(H,30,32)/t27-,29-/m0/s1 |
| InChIKey | OFBANDBMHLEMFA-YTMVLYRLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2S)-1-phenyl-2-palmitoylamino-3-morpholino-1-propanol (CHEBI:75131) is a N-[1-hydroxy-3-(morpholin-4-yl)-1-phenylpropan-2-yl]hexadecanamide (CHEBI:75125) |
| (1S,2S)-1-phenyl-2-palmitoylamino-3-morpholino-1-propanol (CHEBI:75131) is enantiomer of (1R,2R)-1-phenyl-2-palmitoylamino-3-morpholino-1-propanol (CHEBI:75126) |
| Incoming Relation(s) |
| DL-threo-1-phenyl-2-palmitoylamino-3-morpholino-1-propanol (CHEBI:75132) has part (1S,2S)-1-phenyl-2-palmitoylamino-3-morpholino-1-propanol (CHEBI:75131) |
| (1R,2R)-1-phenyl-2-palmitoylamino-3-morpholino-1-propanol (CHEBI:75126) is enantiomer of (1S,2S)-1-phenyl-2-palmitoylamino-3-morpholino-1-propanol (CHEBI:75131) |
| IUPAC Name |
|---|
| N-[(1S,2S)-1-hydroxy-3-(morpholin-4-yl)-1-phenylpropan-2-yl]hexadecanamide |
| Synonyms | Source |
|---|---|
| (1S,threo)-1-phenyl-2-palmitoylamino-3-morpholino-1-propanol | ChemIDplus |
| (1S,threo)-PPMP | ChemIDplus |
| (S,S)-1-phenyl-2-palmitoylamino-3-morpholino-1-propanol | ChemIDplus |
| (1S,2S)-2-hexadecanoylamino-3-morpholino-1-phenylpropan-1-ol | ChemIDplus |
| (1S,2S)-PPMP | ChemIDplus |
| (S,S)-PPMP | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7910702 | Reaxys |