EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | K.C7H5O2 |
| Net Charge | 0 |
| Average Mass | 160.213 |
| Monoisotopic Mass | 159.99266 |
| SMILES | O=C([O-])c1ccccc1.[K+] |
| InChI | InChI=1S/C7H6O2.K/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);/q;+1/p-1 |
| InChIKey | XAEFZNCEHLXOMS-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium benzoate (CHEBI:751303) is a benzoic acids (CHEBI:22723) |
| Synonyms | Source |
|---|---|
| Benzoic acid, potassium salt | ChEMBL |
| E--212 | ChEMBL |
| INS-212 | ChEMBL |
| INS NO.212 | ChEMBL |
| Potassium benzoate | ChEMBL |