EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O14 |
| Net Charge | 0 |
| Average Mass | 564.496 |
| Monoisotopic Mass | 564.14791 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c([C@H]3OC[C@H](O)[C@H](O)[C@H]3O)c(O)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c12 |
| InChI | InChI=1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)15-19(33)14-10(29)5-12(8-1-3-9(28)4-2-8)39-24(14)16(20(15)34)25-22(36)17(31)11(30)7-38-25/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13+,17-,18+,21-,22+,23+,25+,26-/m0/s1 |
| InChIKey | MMDUKUSNQNWVET-LQYCTPBQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Viola philippica (ncbitaxon:316493) | - | PubMed (14519932) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neoschaftoside (CHEBI:7513) has functional parent apigenin (CHEBI:18388) |
| neoschaftoside (CHEBI:7513) has role plant metabolite (CHEBI:76924) |
| neoschaftoside (CHEBI:7513) is a dihydroxyflavone (CHEBI:38686) |
| neoschaftoside (CHEBI:7513) is a flavone C-glycoside (CHEBI:83280) |
| Synonym | Source |
|---|---|
| apigenin 6-C-β-D-glucopyranosyl-8-C-β-L-arabinopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10110 | KEGG COMPOUND |
| C00006382 | KNApSAcK |
| LMPK12110244 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6581044 | Reaxys |
| CAS:61328-41-4 | KEGG COMPOUND |
| CAS:61328-41-4 | ChemIDplus |
| Citations |
|---|