EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23NO2 |
| Net Charge | 0 |
| Average Mass | 297.398 |
| Monoisotopic Mass | 297.17288 |
| SMILES | [H][C@@]12C=CC3=C(N)C(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H23NO2/c1-18-10-8-15(21)17(20)14(18)4-3-11-12-5-6-16(22)19(12,2)9-7-13(11)18/h3-4,8,10-13H,5-7,9,20H2,1-2H3/t11-,12-,13-,18+,19-/m0/s1 |
| InChIKey | DAKHYLIFCYPHQW-KZQROQTASA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| minamestane (CHEBI:751298) has role androgen (CHEBI:50113) |
| minamestane (CHEBI:751298) is a 3-hydroxy steroid (CHEBI:36834) |
| INNs | Source |
|---|---|
| minamestane | WHO MedNet |
| minamestano | WHO MedNet |