EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30N2O5S |
| Net Charge | 0 |
| Average Mass | 398.525 |
| Monoisotopic Mass | 398.18754 |
| SMILES | C[C@H](CSC(=O)[C@@H](C)NC(=O)C1CCCCC1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C19H30N2O5S/c1-12(17(23)21-10-6-9-15(21)18(24)25)11-27-19(26)13(2)20-16(22)14-7-4-3-5-8-14/h12-15H,3-11H2,1-2H3,(H,20,22)(H,24,25)/t12-,13-,15+/m1/s1 |
| InChIKey | QIJLJZOGPPQCOG-NFAWXSAZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| moveltipril (CHEBI:751278) is a N-acyl-amino acid (CHEBI:51569) |
| INN | Source |
|---|---|
| moveltipril | WHO MedNet |
| Synonym | Source |
|---|---|
| Altiopril | ChEMBL |