EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:751230 - fopirtoline
| Formula | C11H15ClN2OS |
| Net Charge | 0 |
| Average Mass | 258.774 |
| Monoisotopic Mass | 258.05936 |
| SMILES | Clc1cccc(SCCN2CCOCC2)n1 |
| InChI | InChI=1S/C11H15ClN2OS/c12-10-2-1-3-11(13-10)16-9-6-14-4-7-15-8-5-14/h1-3H,4-9H2 |
| InChIKey | IEZSLVKNOOIGQP-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fopirtoline (CHEBI:751230) is a chloropyridine (CHEBI:39173) |
| INNs | Source |
|---|---|
| fopirtolina | WHO MedNet |
| fopirtoline | WHO MedNet |