EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14I3NO3 |
| Net Charge | 0 |
| Average Mass | 612.971 |
| Monoisotopic Mass | 612.81079 |
| SMILES | CCN(C(C)=O)c1c(I)cc(I)c(CCC(=O)O)c1I |
| InChI | InChI=1S/C13H14I3NO3/c1-3-17(7(2)18)13-10(15)6-9(14)8(12(13)16)4-5-11(19)20/h6H,3-5H2,1-2H3,(H,19,20) |
| InChIKey | LLLMGEDYKIIGPY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ioprocemic acid (CHEBI:751159) is a benzenes (CHEBI:22712) |
| ioprocemic acid (CHEBI:751159) is a monocarboxylic acid (CHEBI:25384) |
| INNs | Source |
|---|---|
| acide ioprocemique | WHO MedNet |
| acido ioprocemico | WHO MedNet |
| ioprocemic acid | WHO MedNet |
| Synonyms | Source |
|---|---|
| ZK 10 720 | ChEMBL |
| ZK-10720 | ChEMBL |