EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O5 |
| Net Charge | 0 |
| Average Mass | 500.720 |
| Monoisotopic Mass | 500.35017 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@@H](O)C(C)(C)C(=O)OC(C)C)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C31H48O5/c1-19(2)36-29(35)30(5,6)28(34)15-10-20(3)25-13-14-26-22(9-8-16-31(25,26)7)11-12-23-17-24(32)18-27(33)21(23)4/h10-12,15,19-20,24-28,32-34H,4,8-9,13-14,16-18H2,1-3,5-7H3/b15-10+,22-11+,23-12-/t20-,24-,25-,26+,27+,28-,31-/m1/s1 |
| InChIKey | AUMBXYDXKLLKEK-BGMQPCSBSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tisocalcitate (CHEBI:751153) is a vitamin D (CHEBI:27300) |
| INNs | Source |
|---|---|
| tisocalcitate | WHO MedNet |
| tisocalcitato | WHO MedNet |
| Synonyms | Source |
|---|---|
| ZK 156942 | ChEMBL |
| ZK-156942 | ChEMBL |
| ZK156942 | ChEMBL |