EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H38F5N3O3S |
| Net Charge | 0 |
| Average Mass | 735.819 |
| Monoisotopic Mass | 735.25540 |
| SMILES | COCCN1CCC(N(Cc2ccc(-c3ccc(C(F)(F)F)cc3)cc2)C(=O)Cn2c(SCc3cccc(F)c3F)cc(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C40H38F5N3O3S/c1-51-22-21-46-19-17-32(18-20-46)47(24-27-9-11-28(12-10-27)29-13-15-31(16-14-29)40(43,44)45)37(50)25-48-35-8-3-2-6-33(35)36(49)23-38(48)52-26-30-5-4-7-34(41)39(30)42/h2-16,23,32H,17-22,24-26H2,1H3 |
| InChIKey | NNBGCSGCRSCFEA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rilapladib (CHEBI:751149) has role antiatherosclerotic agent (CHEBI:145947) |
| rilapladib (CHEBI:751149) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| rilapladib | WHO MedNet |
| Synonym | Source |
|---|---|
| SB-659032 | ChEMBL |
| Citations |
|---|