EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:751144 - incyclinide
| Formula | C19H17NO7 |
| Net Charge | 0 |
| Average Mass | 371.345 |
| Monoisotopic Mass | 371.10050 |
| SMILES | [H][C@@]12Cc3cccc(O)c3C(=O)C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)C[C@]1([H])C2 |
| InChI | InChI=1S/C19H17NO7/c20-18(26)14-11(22)6-9-5-8-4-7-2-1-3-10(21)12(7)15(23)13(8)16(24)19(9,27)17(14)25/h1-3,8-9,21-22,24,27H,4-6H2,(H2,20,26)/t8-,9-,19-/m0/s1 |
| InChIKey | ZXFCRFYULUUSDW-OWXODZSWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| incyclinide (CHEBI:751144) has role antineoplastic agent (CHEBI:35610) |
| incyclinide (CHEBI:751144) is a tetracyclines (CHEBI:26895) |
| INNs | Source |
|---|---|
| inciclinida | WHO MedNet |
| incyclinide | WHO MedNet |
| Synonyms | Source |
|---|---|
| COL-3 | ChEMBL |
| NSC-683551 | ChEMBL |
| Brand Name | Source |
|---|---|
| Metastat | ChEMBL |
| Citations |
|---|