EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:751135 - aladorian
| Formula | C12H13NO4S |
| Net Charge | 0 |
| Average Mass | 267.306 |
| Monoisotopic Mass | 267.05653 |
| SMILES | COc1ccc2c(c1)CN(C(=O)C(=O)O)CCS2 |
| InChI | InChI=1S/C12H13NO4S/c1-17-9-2-3-10-8(6-9)7-13(4-5-18-10)11(14)12(15)16/h2-3,6H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | FPWBHFYYVSNIFZ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aladorian (CHEBI:751135) is a benzothiazepine (CHEBI:48684) |
| INN | Source |
|---|---|
| aladorian | WHO MedNet |
| Synonyms | Source |
|---|---|
| ARM-036 | ChEMBL |
| ARM036 | ChEMBL |
| S-36 | ChEMBL |
| S36 | ChEMBL |
| S-44121-1 | ChEMBL |
| S-441211 | ChEMBL |
| Citations |
|---|