EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11FO4 |
| Net Charge | 0 |
| Average Mass | 274.247 |
| Monoisotopic Mass | 274.06414 |
| SMILES | CC(=O)Oc1ccc(-c2ccc(F)cc2)cc1C(=O)O |
| InChI | InChI=1S/C15H11FO4/c1-9(17)20-14-7-4-11(8-13(14)15(18)19)10-2-5-12(16)6-3-10/h2-8H,1H3,(H,18,19) |
| InChIKey | XKSAJZSJKURQRX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flufenisal (CHEBI:751111) is a benzoic acids (CHEBI:22723) |
| flufenisal (CHEBI:751111) is a carboxylic ester (CHEBI:33308) |
| flufenisal (CHEBI:751111) is a salicylates (CHEBI:26596) |
| INN | Source |
|---|---|
| flufenisal | WHO MedNet |
| Citations |
|---|