EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO2 |
| Net Charge | 0 |
| Average Mass | 283.371 |
| Monoisotopic Mass | 283.15723 |
| SMILES | [H][C@@]12CC=C(C)[C@]3([H])Oc4c(O)ccc5c4[C@]13CCN(C)[C@]2([H])C5 |
| InChI | InChI=1S/C18H21NO2/c1-10-3-5-12-13-9-11-4-6-14(20)16-15(11)18(12,17(10)21-16)7-8-19(13)2/h3-4,6,12-13,17,20H,5,7-9H2,1-2H3/t12-,13+,17-,18-/m0/s1 |
| InChIKey | CUFWYVOFDYVCPM-GGNLRSJOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyldesorphine (CHEBI:751084) is a morphinane alkaloid (CHEBI:25418) |
| INNs | Source |
|---|---|
| methyldesorphine | WHO MedNet |
| metildesorfina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Dea no. 9302 | ChEMBL |
| .delta.6-deoxy-6-methylmorphine | ChEMBL |
| IDS-NM-004 | ChEMBL |
| Methyldesomorphine | ChEMBL |
| MK 57 | ChEMBL |
| MK-57 | ChEMBL |