EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C14H8ClN2O3S |
| Net Charge | 0 |
| Average Mass | 342.739 |
| Monoisotopic Mass | 341.98419 |
| SMILES | NC(=O)N1C(=O)/C(=C(\[O-])c2cccs2)c2cc(Cl)ccc21.[Na+] |
| InChI | InChI=1S/C14H9ClN2O3S.Na/c15-7-3-4-9-8(6-7)11(13(19)17(9)14(16)20)12(18)10-2-1-5-21-10;/h1-6,18H,(H2,16,20);/q;+1/p-1/b12-11-; |
| InChIKey | VCSAHSDZAKGXAT-AFEZEDKISA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenidap sodium (CHEBI:751072) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonyms | Source |
|---|---|
| CP-66,248-2 | ChEMBL |
| CP-66248-2 | ChEMBL |
| Tenidap sodium salt | ChEMBL |
| Citations |
|---|