EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25Br2NO3 |
| Net Charge | 0 |
| Average Mass | 463.210 |
| Monoisotopic Mass | 461.02012 |
| SMILES | CCOC(=O)COc1c(Br)cc(Br)cc1CN(C)C1CCCCC1 |
| InChI | InChI=1S/C18H25Br2NO3/c1-3-23-17(22)12-24-18-13(9-14(19)10-16(18)20)11-21(2)15-7-5-4-6-8-15/h9-10,15H,3-8,11-12H2,1-2H3 |
| InChIKey | RMBSXTDJPPLMFP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxabrexine (CHEBI:751043) is a monocarboxylic acid (CHEBI:25384) |
| INNs | Source |
|---|---|
| oxabrexina | WHO MedNet |
| oxabrexine | WHO MedNet |