EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14[11C]H20Cl2N2O3 |
| Net Charge | 0 |
| Average Mass | 346.242 |
| Monoisotopic Mass | 345.09653 |
| SMILES | CCN1CCC[C@H]1CNC(=O)c1c(O)c(Cl)cc(Cl)c1O[11CH3] |
| InChI | InChI=1S/C15H20Cl2N2O3/c1-3-19-6-4-5-9(19)8-18-15(21)12-13(20)10(16)7-11(17)14(12)22-2/h7,9,20H,3-6,8H2,1-2H3,(H,18,21)/t9-/m0/s1/i2-1 |
| InChIKey | WAOQONBSWFLFPE-TXWZUYSVSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| raclopride c 11 (CHEBI:751040) has role antidepressant (CHEBI:35469) |
| raclopride c 11 (CHEBI:751040) is a methoxybenzenes (CHEBI:51683) |
| raclopride c 11 (CHEBI:751040) is a phenols (CHEBI:33853) |
| Synonyms | Source |
|---|---|
| (11c)-raclopride | ChEMBL |
| Raclopride c 11 | ChEMBL |
| Raclopride c-11 | ChEMBL |
| Citations |
|---|