EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750957 - aminopterin sodium
| Formula | Na.C19H18N8O5.Na |
| Net Charge | 0 |
| Average Mass | 484.384 |
| Monoisotopic Mass | 484.11955 |
| SMILES | Nc1nc(N)c2nc(CNc3ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])cc3)cnc2n1.[Na+].[Na+] |
| InChI | InChI=1S/C19H20N8O5.2Na/c20-15-14-16(27-19(21)26-15)23-8-11(24-14)7-22-10-3-1-9(2-4-10)17(30)25-12(18(31)32)5-6-13(28)29;;/h1-4,8,12,22H,5-7H2,(H,25,30)(H,28,29)(H,31,32)(H4,20,21,23,26,27);;/q;2*+1/p-2/t12-;;/m0../s1 |
| InChIKey | USOUFAHHWNKDJC-LTCKWSDVSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminopterin sodium (CHEBI:750957) is a glutamic acid derivative (CHEBI:24315) |
| INNs | Source |
|---|---|
| aminopterina de sodio | WHO MedNet |
| aminopterine sodique | WHO MedNet |
| Synonym | Source |
|---|---|
| NSC-257456 | ChEMBL |