EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N5O6S |
| Net Charge | 0 |
| Average Mass | 357.348 |
| Monoisotopic Mass | 357.07430 |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N(OCC(=O)O)[C@H]1C)c1csc(N)n1 |
| InChI | InChI=1S/C12H15N5O6S/c1-5-8(11(21)17(5)23-3-7(18)19)15-10(20)9(16-22-2)6-4-24-12(13)14-6/h4-5,8H,3H2,1-2H3,(H2,13,14)(H,15,20)(H,18,19)/b16-9-/t5-,8-/m0/s1 |
| InChIKey | FJKOYBHMMTVFHK-TWYJFGHKSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oximonam (CHEBI:750910) is a monobactam (CHEBI:50695) |
| INN | Source |
|---|---|
| oximonam | WHO MedNet |
| Synonyms | Source |
|---|---|
| SQ 82291 | ChEMBL |
| SQ-82291 | ChEMBL |