EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750893 - xinidamine
| Formula | C17H16N2O2 |
| Net Charge | 0 |
| Average Mass | 280.327 |
| Monoisotopic Mass | 280.12118 |
| SMILES | Cc1ccc(Cn2nc(C(=O)O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C17H16N2O2/c1-11-7-8-13(12(2)9-11)10-19-15-6-4-3-5-14(15)16(18-19)17(20)21/h3-9H,10H2,1-2H3,(H,20,21) |
| InChIKey | WHWIXTDKNBCRAS-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xinidamine (CHEBI:750893) is a indazoles (CHEBI:38769) |
| INNs | Source |
|---|---|
| xinidamina | WHO MedNet |
| xinidamine | WHO MedNet |
| Citations |
|---|