EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:750860 - tucaresol
| Formula | C15H12O5 |
| Net Charge | 0 |
| Average Mass | 272.256 |
| Monoisotopic Mass | 272.06847 |
| SMILES | O=Cc1c(O)cccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H12O5/c16-8-12-13(17)2-1-3-14(12)20-9-10-4-6-11(7-5-10)15(18)19/h1-8,17H,9H2,(H,18,19) |
| InChIKey | XEDONBRPTABQFB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tucaresol (CHEBI:750860) has role anti-HIV agent (CHEBI:64946) |
| tucaresol (CHEBI:750860) is a benzoic acids (CHEBI:22723) |
| INN | Source |
|---|---|
| tucaresol | WHO MedNet |
| Synonyms | Source |
|---|---|
| 589-C | ChEMBL |
| 589C | ChEMBL |
| Citations |
|---|