EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.C30H31NO3 |
| Net Charge | 0 |
| Average Mass | 549.689 |
| Monoisotopic Mass | 549.21851 |
| SMILES | COc1ccc(C2=C(C(=O)c3ccc(OCCN4CCCC4)cc3)c3ccccc3CC2)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C30H31NO3.CH4O3S/c1-33-25-13-8-23(9-14-25)28-17-12-22-6-2-3-7-27(22)29(28)30(32)24-10-15-26(16-11-24)34-21-20-31-18-4-5-19-31;1-5(2,3)4/h2-3,6-11,13-16H,4-5,12,17-21H2,1H3;1H3,(H,2,3,4) |
| InChIKey | RAHJASYQAFJPFD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trioxifene mesylate (CHEBI:750839) is a diarylheptanoid (CHEBI:78802) |
| Synonyms | Source |
|---|---|
| COMPOUND 133314 | ChEMBL |
| COMPOUND-133314 | ChEMBL |
| Trioxifene mesilate | ChEMBL |
| Trioxifene mesylate | ChEMBL |
| Citations |
|---|