EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750833 - cefmatilen
| Formula | C15H14N8O5S4 |
| Net Charge | 0 |
| Average Mass | 514.596 |
| Monoisotopic Mass | 513.99700 |
| SMILES | [H][C@]12SCC(SCSc3cnnn3)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\O)c1csc(N)n1 |
| InChI | InChI=1S/C15H14N8O5S4/c16-15-18-5(2-30-15)8(21-28)11(24)19-9-12(25)23-10(14(26)27)6(3-29-13(9)23)31-4-32-7-1-17-22-20-7/h1-2,9,13,28H,3-4H2,(H2,16,18)(H,19,24)(H,26,27)(H,17,20,22)/b21-8-/t9-,13-/m1/s1 |
| InChIKey | UEQVTKSAEXANEZ-YCRCPZNHSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefmatilen (CHEBI:750833) is a cephalosporin (CHEBI:23066) |
| INNs | Source |
|---|---|
| cefmatilen | WHO MedNet |
| cefmatilene | WHO MedNet |
| cefmatileno | WHO MedNet |