EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO3 |
| Net Charge | 0 |
| Average Mass | 301.386 |
| Monoisotopic Mass | 301.16779 |
| SMILES | [H][C@@]12CC[C@](C)(O)[C@]3([H])Oc4c(O)ccc5c4[C@]13CCN(C)[C@]2([H])C5 |
| InChI | InChI=1S/C18H23NO3/c1-17(21)6-5-11-12-9-10-3-4-13(20)15-14(10)18(11,16(17)22-15)7-8-19(12)2/h3-4,11-12,16,20-21H,5-9H2,1-2H3/t11-,12+,16-,17-,18-/m0/s1 |
| InChIKey | NBKVWIJQJMEQLE-NGTWOADLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyldihydromorphine (CHEBI:750831) is a morphinane alkaloid (CHEBI:25418) |
| INNs | Source |
|---|---|
| methyldihydromorphine | WHO MedNet |
| metildihidromorfina | WHO MedNet |
| Synonyms | Source |
|---|---|
| DEA NO. 9304 | ChEMBL |
| IDS-NM-005 | ChEMBL |
| Morphine, dihydro-6-methyl- | ChEMBL |