EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H67N5O10 |
| Net Charge | 0 |
| Average Mass | 874.089 |
| Monoisotopic Mass | 873.48879 |
| SMILES | CCc1c(CC)c2cc3nc(cnc4cc(OCCOCCOCCOC)c(OCCOCCOCCOC)cc4ncc4nc(cc1n2)C(CCCO)=C4C)C(C)=C3CCCO |
| InChI | InChI=1S/C48H67N5O10/c1-7-35-36(8-2)40-28-42-38(12-10-14-55)34(4)46(53-42)32-50-44-30-48(63-26-24-61-22-20-59-18-16-57-6)47(62-25-23-60-21-19-58-17-15-56-5)29-43(44)49-31-45-33(3)37(11-9-13-54)41(52-45)27-39(35)51-40/h27-32,51,54-55H,7-26H2,1-6H3/b39-27-,40-28-,41-27-,42-28-,45-31-,46-32-,49-31+,49-43+,50-32+,50-44+ |
| InChIKey | AHNIKTNNZJNCFN-CNEPGKQSSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| motexafin (CHEBI:750823) has role antineoplastic agent (CHEBI:35610) |
| motexafin (CHEBI:750823) is a aromatic ether (CHEBI:35618) |
| INNs | Source |
|---|---|
| motexafin | WHO MedNet |
| motexafina | WHO MedNet |
| motexafine | WHO MedNet |