EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O7.C34H41N3O7.C6H8O7 |
| Net Charge | 0 |
| Average Mass | 987.962 |
| Monoisotopic Mass | 987.34846 |
| SMILES | COc1cc(C(=O)C(=O)N2CCCC[C@H]2C(=O)OC(CCCc2cccnc2)CCCc2cccnc2)cc(OC)c1OC.O=C(O)CC(O)(CC(=O)O)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C34H41N3O7.2C6H8O7/c1-41-29-20-26(21-30(42-2)32(29)43-3)31(38)33(39)37-19-5-4-16-28(37)34(40)44-27(14-6-10-24-12-8-17-35-22-24)15-7-11-25-13-9-18-36-23-25;2*7-3(8)1-6(13,5(11)12)2-4(9)10/h8-9,12-13,17-18,20-23,27-28H,4-7,10-11,14-16,19H2,1-3H3;2*13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t28-;;/m0../s1 |
| InChIKey | VDMKJSJJXQDICL-ZXVJYWQYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biricodar dicitrate (CHEBI:750820) has role antineoplastic agent (CHEBI:35610) |
| biricodar dicitrate (CHEBI:750820) is a α-amino acid ester (CHEBI:46874) |
| Synonyms | Source |
|---|---|
| VX-710 | ChEMBL |
| VX-710-3 | ChEMBL |
| VX-71O-3 | ChEMBL |