EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750814 - iodecimol
| Formula | C35H44I6N6O16 |
| Net Charge | 0 |
| Average Mass | 1566.187 |
| Monoisotopic Mass | 1565.70822 |
| SMILES | O=C(NC(CO)CO)c1c(I)c(C(=O)NC(CO)CO)c(I)c(N(CCO)C(=O)CC(=O)N(CCO)c2c(I)c(C(=O)NC(CO)CO)c(I)c(C(=O)NC(CO)CO)c2I)c1I |
| InChI | InChI=1S/C35H44I6N6O16/c36-24-20(32(60)42-14(6-50)7-51)26(38)30(27(39)21(24)33(61)43-15(8-52)9-53)46(1-3-48)18(58)5-19(59)47(2-4-49)31-28(40)22(34(62)44-16(10-54)11-55)25(37)23(29(31)41)35(63)45-17(12-56)13-57/h14-17,48-57H,1-13H2,(H,42,60)(H,43,61)(H,44,62)(H,45,63) |
| InChIKey | RHISTIGVAKTTCM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodecimol (CHEBI:750814) is a amidobenzoic acid (CHEBI:48470) |
| INN | Source |
|---|---|
| iodecimol | WHO MedNet |