EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H46N6O13 |
| Net Charge | 0 |
| Average Mass | 614.650 |
| Monoisotopic Mass | 614.31229 |
| SMILES | NC[C@@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3N)O[C@@H]2CO)[C@H](N)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H46N6O13/c24-2-7-13(32)15(34)10(28)21(37-7)40-18-6(27)1-5(26)12(31)20(18)42-23-17(36)19(9(4-30)39-23)41-22-11(29)16(35)14(33)8(3-25)38-22/h5-23,30-36H,1-4,24-29H2/t5-,6+,7-,8+,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | PGBHMTALBVVCIT-VCIWKGPPSA-N |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. antibacterial drug A drug used to treat or prevent bacterial infections. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| framycetin (CHEBI:7508) has role Escherichia coli metabolite (CHEBI:76971) |
| framycetin (CHEBI:7508) has role allergen (CHEBI:50904) |
| framycetin (CHEBI:7508) has role antibacterial drug (CHEBI:36047) |
| framycetin (CHEBI:7508) has role nasal decongestant (CHEBI:77715) |
| framycetin (CHEBI:7508) has role ophthalmology drug (CHEBI:66981) |
| framycetin (CHEBI:7508) is a aminoglycoside (CHEBI:47779) |
| framycetin (CHEBI:7508) is conjugate base of framycetin(6+) (CHEBI:87835) |
| Incoming Relation(s) |
| neomycin (CHEBI:7507) has part framycetin (CHEBI:7508) |
| neomycin B sulfate (CHEBI:53636) has part framycetin (CHEBI:7508) |
| framycetin(6+) (CHEBI:87835) is conjugate acid of framycetin (CHEBI:7508) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2-{[3-O-(2,6-diamino-2,6-dideoxy-β-L-idopyranosyl)-β-D-ribofuranosyl]oxy}-3-hydroxycyclohexyl 2,6-diamino-2,6-dideoxy-α-D-glucopyranoside |
| INNs | Source |
|---|---|
| framicetina | ChemIDplus |
| framycetine | ChemIDplus |
| framycetinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Actilin | ChEMBL |
| Antibiotic 10676 | ChEMBL |
| ANTIBIOTIQUE EF 185 | ChEMBL |
| Dekamycin iii | ChEMBL |
| Enterfram | ChEMBL |
| Fradiomycin B | KEGG COMPOUND |
| Citations |
|---|