EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7508 - framycetin
| Formula | C23H46N6O13 |
| Net Charge | 0 |
| Average Mass | 614.650 |
| Monoisotopic Mass | 614.31229 |
| SMILES | NC[C@@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3N)O[C@@H]2CO)[C@H](N)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H46N6O13/c24-2-7-13(32)15(34)10(28)21(37-7)40-18-6(27)1-5(26)12(31)20(18)42-23-17(36)19(9(4-30)39-23)41-22-11(29)16(35)14(33)8(3-25)38-22/h5-23,30-36H,1-4,24-29H2/t5-,6+,7-,8+,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | PGBHMTALBVVCIT-VCIWKGPPSA-N |
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. antibacterial drug A drug used to treat or prevent bacterial infections. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| framycetin (CHEBI:7508) has role Escherichia coli metabolite (CHEBI:76971) |
| framycetin (CHEBI:7508) has role allergen (CHEBI:50904) |
| framycetin (CHEBI:7508) has role antibacterial drug (CHEBI:36047) |
| framycetin (CHEBI:7508) has role nasal decongestant (CHEBI:77715) |
| framycetin (CHEBI:7508) has role ophthalmology drug (CHEBI:66981) |
| framycetin (CHEBI:7508) is a aminoglycoside (CHEBI:47779) |
| framycetin (CHEBI:7508) is conjugate base of framycetin(6+) (CHEBI:87835) |
| Incoming Relation(s) |
| neomycin (CHEBI:7507) has part framycetin (CHEBI:7508) |
| neomycin B sulfate (CHEBI:53636) has part framycetin (CHEBI:7508) |
| framycetin(6+) (CHEBI:87835) is conjugate acid of framycetin (CHEBI:7508) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diamino-2-{[3-O-(2,6-diamino-2,6-dideoxy-β-L-idopyranosyl)-β-D-ribofuranosyl]oxy}-3-hydroxycyclohexyl 2,6-diamino-2,6-dideoxy-α-D-glucopyranoside |
| INNs | Source |
|---|---|
| framicetina | ChemIDplus |
| framycetine | ChemIDplus |
| framycetinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Actilin | ChEMBL |
| Antibiotic 10676 | ChEMBL |
| ANTIBIOTIQUE EF 185 | ChEMBL |
| Dekamycin iii | ChEMBL |
| Enterfram | ChEMBL |
| Fradiomycin B | KEGG COMPOUND |
| Citations |
|---|