EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25NO2 |
| Net Charge | 0 |
| Average Mass | 311.425 |
| Monoisotopic Mass | 311.18853 |
| SMILES | [H][C@@]12CCC(=O)C[C@@]13CCN(CC1CC1)[C@]2([H])Cc1cccc(O)c13 |
| InChI | InChI=1S/C20H25NO2/c22-15-6-7-16-17-10-14-2-1-3-18(23)19(14)20(16,11-15)8-9-21(17)12-13-4-5-13/h1-3,13,16-17,23H,4-12H2/t16-,17+,20-/m0/s1 |
| InChIKey | ORMBBVGVPWUEMQ-QKLQHJQFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ketorfanol (CHEBI:750798) is a morphinane alkaloid (CHEBI:25418) |
| INN | Source |
|---|---|
| ketorfanol | WHO MedNet |
| Synonym | Source |
|---|---|
| SBW-22 | ChEMBL |