EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40N2O3 |
| Net Charge | 0 |
| Average Mass | 464.650 |
| Monoisotopic Mass | 464.30389 |
| SMILES | [H][C@@]12CC[C@@]3([H])NC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](C(=O)NC(C)(C)c3ccc(OC)cc3)CC[C@@]21[H] |
| InChI | InChI=1S/C29H40N2O3/c1-27(2,18-6-8-19(34-5)9-7-18)31-26(33)23-12-11-21-20-10-13-24-29(4,17-15-25(32)30-24)22(20)14-16-28(21,23)3/h6-9,15,17,20-24H,10-14,16H2,1-5H3,(H,30,32)(H,31,33)/t20-,21-,22-,23+,24+,28-,29+/m0/s1 |
| InChIKey | NAGKTIAFDQEFJI-DPMIIFTQSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lapisteride (CHEBI:750793) has role androgen (CHEBI:50113) |
| lapisteride (CHEBI:750793) is a 3-hydroxy steroid (CHEBI:36834) |
| INNs | Source |
|---|---|
| lapisterida | WHO MedNet |
| lapisteride | WHO MedNet |