EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N2O5 |
| Net Charge | 0 |
| Average Mass | 258.274 |
| Monoisotopic Mass | 258.12157 |
| SMILES | CN(CC(=O)NO)C(=O)[C@@H]1CCCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H18N2O5/c1-13(6-9(14)12-18)10(15)7-4-2-3-5-8(7)11(16)17/h7-8,18H,2-6H2,1H3,(H,12,14)(H,16,17)/t7-,8+/m1/s1 |
| InChIKey | QKIVRALZQSUWHH-SFYZADRCSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| idrapril (CHEBI:750773) is a α-amino acid (CHEBI:33704) |
| INN | Source |
|---|---|
| idrapril | WHO MedNet |