EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C4H8O6S4.Na |
| Net Charge | 0 |
| Average Mass | 326.350 |
| Monoisotopic Mass | 325.89991 |
| SMILES | O=S(=O)([O-])CCSSCCS(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H10O6S4.2Na/c5-13(6,7)3-1-11-12-2-4-14(8,9)10;;/h1-4H2,(H,5,6,7)(H,8,9,10);;/q;2*+1/p-2 |
| InChIKey | KQYGMURBTJPBPQ-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimesna (CHEBI:750766) has role antineoplastic agent (CHEBI:35610) |
| dimesna (CHEBI:750766) is a organosulfonic acid (CHEBI:33551) |
| Synonyms | Source |
|---|---|
| BNP-7787 | ChEMBL |
| BNP7787 | ChEMBL |
| NSC-716976 | ChEMBL |
| NSC-760345 | ChEMBL |
| Tavocept | ChEMBL |