EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:750756 - dichloroxylenol
| Formula | C8H8Cl2O |
| Net Charge | 0 |
| Average Mass | 191.057 |
| Monoisotopic Mass | 189.99522 |
| SMILES | Cc1cc(O)c(Cl)c(C)c1Cl |
| InChI | InChI=1S/C8H8Cl2O/c1-4-3-6(11)8(10)5(2)7(4)9/h3,11H,1-2H3 |
| InChIKey | IYOLBFFHPZOQGW-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dichloroxylenol (CHEBI:750756) is a dichlorobenzene (CHEBI:23697) |
| INNs | Source |
|---|---|
| dichloroxylenol | WHO MedNet |
| dicloroxilenol | WHO MedNet |
| Synonyms | Source |
|---|---|
| Decasept | ChEMBL |
| Dichloro-m-xylenol | ChEMBL |
| Dixol | ChEMBL |
| Hewsol | ChEMBL |
| NSC-9774 | ChEMBL |
| Prinsyl | ChEMBL |