EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15I3N2O6 |
| Net Charge | 0 |
| Average Mass | 700.005 |
| Monoisotopic Mass | 699.80643 |
| SMILES | CCOC(=O)COC(=O)c1c(I)c(NC(C)=O)c(I)c(NC(C)=O)c1I |
| InChI | InChI=1S/C15H15I3N2O6/c1-4-25-8(23)5-26-15(24)9-10(16)13(19-6(2)21)12(18)14(11(9)17)20-7(3)22/h4-5H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | BZHSRUIDLJDTTJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl cartrizoate (CHEBI:750741) is a amidobenzoic acid (CHEBI:48470) |
| INNs | Source |
|---|---|
| cartrizoate d'ethyle | WHO MedNet |
| cartrizoato de etilo | WHO MedNet |
| ethyl cartrizoate | WHO MedNet |